cas: 1801739-59-2 — see every product listed under this CAS number, including other names
H-DL-Phg(3-F)-NH2 HCl 95% (CAS 1801739-59-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1166572-250mg |
| cas | 1801739-59-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 609.56 Pln | |
| Ambeed | 1g | 1516.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1166572 |
2-amino-2-(3-fluorophenyl)acetamide;hydrochloride (CAS 1801739-59-2) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 2-amino-2-(3-fluorophenyl)acetamide;hydrochloride. InChIKey: JUUBYIUVFVRZNB-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 2-amino-2-(3-fluorophenyl)acetamide;hydrochloride |
| InChIKey | JUUBYIUVFVRZNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)N)N.Cl |
Computed by PubChem (NCBI)