CAS 1801739-59-2 appears in our catalog under these names: 2–Amino–2–(3–fluorophenyl)acetamide hydrochloride, 2-Amino-2-(3-fluorophenyl)acetamide hydrochloride, 95%, 2-Amino-2-(3-fluorophenyl)acetamide hydrochloride, 97%, 2-Amino-2-(3-fluorophenyl)acetamide hydrochloride, 95%, 95%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-amino-2-(3-fluorophenyl)acetamide;hydrochloride (CAS 1801739-59-2) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 2-amino-2-(3-fluorophenyl)acetamide;hydrochloride. InChIKey: JUUBYIUVFVRZNB-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 2-amino-2-(3-fluorophenyl)acetamide;hydrochloride |
| InChIKey | JUUBYIUVFVRZNB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(C(=O)N)N.Cl |
Computed by PubChem (NCBI)