CAS 318951-78-9 is the registry number for 2-(4-Fluorophenoxy)-1-imino-1-ethanaminium chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(4-fluorophenoxy)ethanimidamide;hydrochloride (CAS 318951-78-9) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 2-(4-fluorophenoxy)ethanimidamide;hydrochloride. InChIKey: GVELHLWKCQWEDO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 2-(4-fluorophenoxy)ethanimidamide;hydrochloride |
| InChIKey | GVELHLWKCQWEDO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCC(=N)N)F.Cl |
Computed by PubChem (NCBI)