CAS 1242840-35-2 is the registry number for 5-Amino-2-fluoro-n-methylbenzamide hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
5-amino-2-fluoro-N-methylbenzamide;hydrochloride (CAS 1242840-35-2) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 5-amino-2-fluoro-N-methylbenzamide;hydrochloride. InChIKey: SQEVKPIDBHRSSO-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 5-amino-2-fluoro-N-methylbenzamide;hydrochloride |
| InChIKey | SQEVKPIDBHRSSO-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=C(C=CC(=C1)N)F.Cl |
Computed by PubChem (NCBI)