CAS 1185371-64-5 appears in our catalog under these names: 2-(3-Fluorophenoxy)ethanimidamide hydrochloride, 95%, 2-(3-Fluorophenoxy)acetimidamide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 10g, 50g, 1g, 5g.
2-(3-fluorophenoxy)ethanimidamide;hydrochloride (CAS 1185371-64-5) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 2-(3-fluorophenoxy)ethanimidamide;hydrochloride. InChIKey: PJQWQBVVUQXWDG-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 2-(3-fluorophenoxy)ethanimidamide;hydrochloride |
| InChIKey | PJQWQBVVUQXWDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)OCC(=N)N.Cl |
Computed by PubChem (NCBI)