Products 1417825-37-6
CAS 1417825-37-6 is the registry number for 4-Fluoro-2-methoxybenzimidamide hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-fluoro-2-methoxybenzenecarboximidamide;hydrochloride (CAS 1417825-37-6) is a chemical compound with the molecular formula C8H10ClFN2O and a molecular weight of 204.63 g/mol. IUPAC name: 4-fluoro-2-methoxybenzenecarboximidamide;hydrochloride. InChIKey: SSQJCWTYXQYGGN-UHFFFAOYSA-N.
| Molecular formula | C8H10ClFN2O |
|---|---|
| Molecular weight | 204.63 g/mol |
| IUPAC name | 4-fluoro-2-methoxybenzenecarboximidamide;hydrochloride |
| InChIKey | SSQJCWTYXQYGGN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)F)C(=N)N.Cl |
Computed by PubChem (NCBI)