CAS 19789-59-4 appears in our catalog under these names: α-Amino-4-methoxybenzeneacetic acid, 98%, 98%, 2-Amino-2-(4-methoxyphenyl)acetic acid, 98%, α–Aminohomoanisic acid. Offered by: Chemat, Fluorochem, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 2.5g, 10g, 100g.
2-amino-2-(4-methoxyphenyl)acetic acid (CAS 19789-59-4) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 181.19 g/mol. IUPAC name: 2-amino-2-(4-methoxyphenyl)acetic acid. InChIKey: GXUAKXUIILGDKW-UHFFFAOYSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 181.19 g/mol |
| IUPAC name | 2-amino-2-(4-methoxyphenyl)acetic acid |
| InChIKey | GXUAKXUIILGDKW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)