Products 7292-80-0
CAS 7292-80-0 appears in our catalog under these names: Amino[4-(methylsulfanyl)phenyl]acetic acid, 98%, AMINO[4-(METHYLSULFANYL)PHENYL]ACETIC ACID, 95%, 95%, H-DL-Phg(4-SMe)-OH, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-amino-2-(4-methylsulfanylphenyl)acetic acid (CAS 7292-80-0) is a chemical compound with the molecular formula C9H11NO2S and a molecular weight of 197.26 g/mol. IUPAC name: 2-amino-2-(4-methylsulfanylphenyl)acetic acid. InChIKey: ZWKWPONGVMNKOM-UHFFFAOYSA-N.
| Molecular formula | C9H11NO2S |
|---|---|
| Molecular weight | 197.26 g/mol |
| IUPAC name | 2-amino-2-(4-methylsulfanylphenyl)acetic acid |
| InChIKey | ZWKWPONGVMNKOM-UHFFFAOYSA-N |
| SMILES | CSC1=CC=C(C=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
amino[4-(methylsulfanyl)phenyl]acetic acid, 2-amino-2-(4-methylsulfanylphenyl)acetic Acid, 2-Amino-2-(4-(methylthio)phenyl)acetic acid, 2-amino-2-[4-(methylsulfanyl)phenyl]acetic acid, Benzeneacetic acid, alpha-amino-4-(methylthio)-, Amino[4-(methylsulfanyl)phenyl]acetic acid (H-DL-Phg(SMe)-OH)