H-DL-Trp(6-Br)-OH 98%
cas: 33599-61-0 — see every product listed under this CAS number, including other names
H-DL-Trp(6-Br)-OH 98% (CAS 33599-61-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A562928-250mg |
| cas | 33599-61-0 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 398.19 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2133.69 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A562928 |
2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid (CAS 33599-61-0) is a chemical compound with the molecular formula C11H11BrN2O2 and a molecular weight of 283.12 g/mol. IUPAC name: 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid. InChIKey: OAORYCZPERQARS-UHFFFAOYSA-N.
| Molecular formula | C11H11BrN2O2 |
|---|---|
| Molecular weight | 283.12 g/mol |
| IUPAC name | 2-amino-3-(6-bromo-1H-indol-3-yl)propanoic acid |
| InChIKey | OAORYCZPERQARS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)NC=C2CC(C(=O)O)N |
Computed by PubChem (NCBI)