CAS 103614-40-0 appears in our catalog under these names: N–Me–Ala–OtBu · HCl, (S)-tert-Butyl 2-(methylamino)propanoate hydrochloride, 98%, 98%, (S)-tert-Butyl 2-(methylamino)propanoate hydrochloride, 97%, H-N-Me-Ala-OtBu·HCl, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 10g, 25g, 15g, 100g, 500g.
Tert-butyl (2S)-2-(methylamino)propanoate;hydrochloride (CAS 103614-40-0) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: tert-butyl (2S)-2-(methylamino)propanoate;hydrochloride. InChIKey: PFFJYAVJRFRTKL-RGMNGODLSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | tert-butyl (2S)-2-(methylamino)propanoate;hydrochloride |
| InChIKey | PFFJYAVJRFRTKL-RGMNGODLSA-N |
| SMILES | C[C@@H](C(=O)OC(C)(C)C)NC.Cl |
Computed by PubChem (NCBI)