Products 405513-14-6
CAS 405513-14-6 is the registry number for N-Me-D-Ala-OtBu hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
Tert-butyl (2R)-2-(methylamino)propanoate;hydrochloride (CAS 405513-14-6) is a chemical compound with the molecular formula C8H18ClNO2 and a molecular weight of 195.69 g/mol. IUPAC name: tert-butyl (2R)-2-(methylamino)propanoate;hydrochloride. InChIKey: PFFJYAVJRFRTKL-FYZOBXCZSA-N.
| Molecular formula | C8H18ClNO2 |
|---|---|
| Molecular weight | 195.69 g/mol |
| IUPAC name | tert-butyl (2R)-2-(methylamino)propanoate;hydrochloride |
| InChIKey | PFFJYAVJRFRTKL-FYZOBXCZSA-N |
| SMILES | C[C@H](C(=O)OC(C)(C)C)NC.Cl |
Computed by PubChem (NCBI)
Synonyms:
(R)-tert-Butyl 2-(methylamino)propanoate hydrochloride, N-ME-D-ALA-OTBU HCL, N-Me-D-Ala-OtBu hydrochloride, tert-butyl (2R)-2-(methylamino)propanoate;hydrochloride, tert-Butyl methyl-D-alaninate hydrochloride, H-D-MeAla-OtBu.HCl, N-Methyl-D-alanine tert-butyl ester hydrochloride, N-alpha-Methyl-D-alanine t-butyl ester hydrochloride, (R)-tert-Butyl2-(methylamino)propanoatehydrochloride, N-D-Me-Ala-OtBu inverted exclamation mark currencyHCl