cas: 2577-40-4 — see every product listed under this CAS number, including other names
H-Phe-Phe-OH, 99.66% (CAS 2577-40-4) is a chemical reagent available from Chemat. Available pack sizes: 25 g, 1 g, 5 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W007970-25 g |
| cas | 2577-40-4 |
| size | 25 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 25 g | 1183.48 Pln | |
| MedChemExpress | 1 g | 263.96 Pln | |
| MedChemExpress | 5 g | 505.45 Pln | |
| MedChemExpress | 10 g | 705.14 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.66% |
Phe-Phe is a dipeptide formed from two L-phenylalanine residues. It has a role as a Mycoplasma genitalium metabolite and a human blood serum metabolite. It is functionally related to a L-phenylalanine. It is a tautomer of a Phe-Phe zwitterion.
Source: ChEBI
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | GKZIWHRNKRBEOH-HOTGVXAUSA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)N[C@@H](CC2=CC=CC=C2)C(=O)O)N |
Computed by PubChem (NCBI)