CAS 58607-69-5 appears in our catalog under these names: D-Phenylalaninyl-D-Phenylalanine, H–D–Phe–D–Phe–OH, H-D-Phe-D-Phe-OH, (R)-2-((R)-2-Amino-3-phenylpropanamido)-3-phenylpropanoic acid, 95%, 95%, (R)-2-((R)-2-Amino-3-phenylpropanamido)-3-phenylpropanoic acid, 95%. Offered by: Chemat Brand, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: on request, 1g, 250mg, 500mg, 1000mg, 2000mg, 100mg, 5g.
(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid (CAS 58607-69-5) is a chemical compound with the molecular formula C18H20N2O3 and a molecular weight of 312.4 g/mol. IUPAC name: (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid. InChIKey: GKZIWHRNKRBEOH-HZPDHXFCSA-N.
| Molecular formula | C18H20N2O3 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | GKZIWHRNKRBEOH-HZPDHXFCSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)N[C@H](CC2=CC=CC=C2)C(=O)O)N |
Computed by PubChem (NCBI)