cas: 60022-62-0 — see every product listed under this CAS number, including other names
H-Ser-OBzl HCl, 95%, 95% (CAS 60022-62-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114618-1g |
| cas | 60022-62-0 |
| size | 1g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 141.20 Pln | |
| Chemat | 50g | 218.00 Pln | |
| Chemat | 100g | 371.60 Pln | |
| Chemat | 250g | 784.40 Pln | |
| Chemat | 500g | 1512.00 Pln | |
| Chemat | 1kg | 2800.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride (CAS 60022-62-0) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride. InChIKey: MGZWCDQAKCHOBX-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-hydroxypropanoate;hydrochloride |
| InChIKey | MGZWCDQAKCHOBX-FVGYRXGTSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)[C@H](CO)N.Cl |
Computed by PubChem (NCBI)