Products 1881328-96-6

CAS 1881328-96-6 is the registry number for propan-2-yl 3-amino-4-hydroxybenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Propan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride (CAS 1881328-96-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: propan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride. InChIKey: KILMMVZNOIAGNU-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14ClNO3
Molecular weight231.67 g/mol
IUPAC namepropan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride
InChIKeyKILMMVZNOIAGNU-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C1=CC(=C(C=C1)O)N.Cl

Computed by PubChem (NCBI)