CAS 1881328-96-6 is the registry number for propan-2-yl 3-amino-4-hydroxybenzoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Propan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride (CAS 1881328-96-6) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: propan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride. InChIKey: KILMMVZNOIAGNU-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | propan-2-yl 3-amino-4-hydroxybenzoate;hydrochloride |
| InChIKey | KILMMVZNOIAGNU-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=CC(=C(C=C1)O)N.Cl |
Computed by PubChem (NCBI)