cas: 4378-13-6 — see every product listed under this CAS number, including other names
H-Thr(tBu)-OH, 97%, 97% (CAS 4378-13-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118459-1g |
| cas | 4378-13-6 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 150.80 Pln | |
| Chemat | 100g | 414.80 Pln | |
| Chemat | 500g | 1704.00 Pln | |
| Chemat | 1kg | 2699.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 4378-13-6) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: NMJINEMBBQVPGY-RITPCOANSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | NMJINEMBBQVPGY-RITPCOANSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OC(C)(C)C |
Computed by PubChem (NCBI)