cas: 4378-13-6 — see every product listed under this CAS number, including other names
O-tert-Butyl-L-threonine, >98.0%(T) (CAS 4378-13-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B3398-1G |
| cas | 4378-13-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 5g | 256.03 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
(2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid (CAS 4378-13-6) is a chemical compound with the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. IUPAC name: (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid. InChIKey: NMJINEMBBQVPGY-RITPCOANSA-N.
| Molecular formula | C8H17NO3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | (2S,3R)-2-amino-3-[(2-methylpropan-2-yl)oxy]butanoic acid |
| InChIKey | NMJINEMBBQVPGY-RITPCOANSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)N)OC(C)(C)C |
Computed by PubChem (NCBI)