CAS 35998-29-9 appears in our catalog under these names: HBED/ 99.53% (existing batch purity), HBED, N,N'-1,2-ethanediylbis(N-((2-hydroxyphenyl)methyl)-glycine, 2,2'-(Ethane-1,2-diylbis((2-hydroxybenzyl)azanediyl))diacetic acid, 98%, 98%, HBED, 98.00%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 10 mg, 5 mg, 25 mg.
2-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid (CAS 35998-29-9) is a chemical compound with the molecular formula C20H24N2O6 and a molecular weight of 388.4 g/mol. IUPAC name: 2-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid. InChIKey: GRUVVLWKPGIYEG-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O6 |
|---|---|
| Molecular weight | 388.4 g/mol |
| IUPAC name | 2-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl-[(2-hydroxyphenyl)methyl]amino]acetic acid |
| InChIKey | GRUVVLWKPGIYEG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN(CCN(CC2=CC=CC=C2O)CC(=O)O)CC(=O)O)O |
Computed by PubChem (NCBI)