Products 927885-00-5
CAS 927885-00-5 appears in our catalog under these names: HS-1793/ 98.16% (existing batch purity), HS-1793, ≥98%, ≥98%, HS-1793, 99.26%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10 mg, 5 mg.
4-(6-hydroxynaphthalen-2-yl)benzene-1,3-diol (CAS 927885-00-5) is a chemical compound with the molecular formula C16H12O3 and a molecular weight of 252.26 g/mol. IUPAC name: 4-(6-hydroxynaphthalen-2-yl)benzene-1,3-diol. InChIKey: BXZJBSHLEZAMOP-UHFFFAOYSA-N.
| Molecular formula | C16H12O3 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 4-(6-hydroxynaphthalen-2-yl)benzene-1,3-diol |
| InChIKey | BXZJBSHLEZAMOP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)O)C=C1C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)