Products 118666-03-8
CAS 118666-03-8 appears in our catalog under these names: HTS07545/ 99.32% (existing batch purity), HTS07545, HTS07545, 99.94%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM (in 1ml dmso).
Ethyl 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)oxy]acetate (CAS 118666-03-8) is a chemical compound with the molecular formula C22H18N2O3 and a molecular weight of 358.4 g/mol. IUPAC name: ethyl 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)oxy]acetate. InChIKey: PZNJITRXQKRPFY-UHFFFAOYSA-N.
| Molecular formula | C22H18N2O3 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | ethyl 2-[(3-cyano-4,6-diphenyl-2-pyridinyl)oxy]acetate |
| InChIKey | PZNJITRXQKRPFY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=C(C(=CC(=N1)C2=CC=CC=C2)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)