CAS 186611-52-9 appears in our catalog under these names: IC261, IC261/ 99.86% (existing batch purity), IC 261, >98.0%(HPLC), 1,3-Dihydro-3-[(2,4,6-trimethoxyphenyl)methylene]-2H-indol-2-one, 98%, 98%, IC261, 99.63%. Offered by: GLPBio, TargetMol, Biosynth, TCI, Chemat. Available pack sizes: 10mg, 5mg, 50mg, 25mg, 100mg, 200mg, 250mg, 1g.
(3E)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one (CAS 186611-52-9) is a chemical compound with the molecular formula C18H17NO4 and a molecular weight of 311.3 g/mol. IUPAC name: (3E)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one. InChIKey: JBJYTZXCZDNOJW-JLHYYAGUSA-N.
| Molecular formula | C18H17NO4 |
|---|---|
| Molecular weight | 311.3 g/mol |
| IUPAC name | (3E)-3-[(2,4,6-trimethoxyphenyl)methylidene]-1H-indol-2-one |
| InChIKey | JBJYTZXCZDNOJW-JLHYYAGUSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=C/2\C3=CC=CC=C3NC2=O)OC |
Computed by PubChem (NCBI)