Products 1584121-99-2
CAS 1584121-99-2 appears in our catalog under these names: IT-901/ 98.06% (existing batch purity), IT–901, IT-901 98%, 5-((2,4-Dimethoxynaphthalen-1-yl)methylene)-2-thioxodihydropyrimidine-4,6(1H,5H)-dione, 98%, 98%, IT-901, 99.32%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg, 1g.
5-[(2,4-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 1584121-99-2) is a chemical compound with the molecular formula C17H14N2O4S and a molecular weight of 342.4 g/mol. IUPAC name: 5-[(2,4-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: JHOPCCOYRKEHQU-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O4S |
|---|---|
| Molecular weight | 342.4 g/mol |
| IUPAC name | 5-[(2,4-dimethoxynaphthalen-1-yl)methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | JHOPCCOYRKEHQU-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=CC=CC=C21)C=C3C(=O)NC(=S)NC3=O)OC |
Computed by PubChem (NCBI)