cas: 482-44-0 — see every product listed under this CAS number, including other names
Imperatorin 97% (CAS 482-44-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118402-1mg |
| cas | 482-44-0 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 136.75 Pln | |
| Ambeed | 10mg | 209.06 Pln | |
| Ambeed | 50mg | 286.94 Pln | |
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1460.62 Pln | |
| Ambeed | 5g | 4948.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118402 |
Imperatorin is a member of the class of psoralens that is psoralen substituted by a prenyloxy group at position 8. Isolated from Angelica dahurica and Angelica koreana, it acts as a acetylcholinesterase inhibitor. It has a role as a metabolite and an EC 3.1.1.7 (acetylcholinesterase) inhibitor.
Source: ChEBI
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 9-(3-methylbut-2-enoxy)furo[3,2-g]chromen-7-one |
| InChIKey | OLOOJGVNMBJLLR-UHFFFAOYSA-N |
| SMILES | CC(=CCOC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)C |
Computed by PubChem (NCBI)