Products 100643-96-7
CAS 100643-96-7 appears in our catalog under these names: Indolidan/ 99.6% (existing batch purity), Indolidan. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
3,3-dimethyl-5-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-1H-indol-2-one (CAS 100643-96-7) is a chemical compound with the molecular formula C14H15N3O2 and a molecular weight of 257.29 g/mol. IUPAC name: 3,3-dimethyl-5-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-1H-indol-2-one. InChIKey: LZCQFJKUAIWHRW-UHFFFAOYSA-N.
| Molecular formula | C14H15N3O2 |
|---|---|
| Molecular weight | 257.29 g/mol |
| IUPAC name | 3,3-dimethyl-5-(6-oxo-4,5-dihydro-1H-pyridazin-3-yl)-1H-indol-2-one |
| InChIKey | LZCQFJKUAIWHRW-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=C2)C3=NNC(=O)CC3)NC1=O)C |
Computed by PubChem (NCBI)