CAS 39012-01-6 appears in our catalog under these names: Iristectorigenin A/ 99.9%, Iristectorigenin A, 5,7-Dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-6-methoxy-4H-chromen-4-one, 99.97% ,, 99.97% ,, Iristectorigenin A, 99.65%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 10 mg, 5 mg.
5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one (CAS 39012-01-6) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one. InChIKey: WRZOUWHPDDOJNR-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| InChIKey | WRZOUWHPDDOJNR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
Computed by PubChem (NCBI)