CAS 86849-77-6 appears in our catalog under these names: Iristectorigenin B, Iristectorigenin B/ 98%, Iristectorigenin B, 5,7-Dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxy-4H-1-benzopyran-4-one, 98.00% ,, 98.00% ,, Iristectorigenin B, 99.48%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 25mg, 5mg, 2mg, 5 mg, 25 mg, 10 mg.
5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one (CAS 86849-77-6) is a chemical compound with the molecular formula C17H14O7 and a molecular weight of 330.29 g/mol. IUPAC name: 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one. InChIKey: WRZOUWHPDDOJNR-UHFFFAOYSA-N.
| Molecular formula | C17H14O7 |
|---|---|
| Molecular weight | 330.29 g/mol |
| IUPAC name | 5,7-dihydroxy-3-(3-hydroxy-4-methoxyphenyl)-6-methoxychromen-4-one |
| InChIKey | WRZOUWHPDDOJNR-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=COC3=C(C2=O)C(=C(C(=C3)O)OC)O)O |
Computed by PubChem (NCBI)