Isobutyl 2-acetoxybenzoate, 95%
cas: 98092-25-2 — see every product listed under this CAS number, including other names
Isobutyl 2-acetoxybenzoate, 95% (CAS 98092-25-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1722650-250mg |
| cas | 98092-25-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1215.88 Pln | |
| Ambeed | 1g | 3257.31 Pln | |
| BLDpharm | 100mg | 664.24 Pln | |
| BLDpharm | 250mg | 1191.83 Pln | |
| BLDpharm | 1g | 3191.12 Pln | |
| Chemat | 100mg | 448.40 Pln | |
| Chemat | 250mg | 765.20 Pln | |
| Chemat | 1g | 2022.80 Pln | |
| Fluorochem | 100mg | 810.15 Pln | |
| Fluorochem | 250mg | 1419.31 Pln | |
| Fluorochem | 1g | 3736.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-methylpropyl 2-acetyloxybenzoate (CAS 98092-25-2) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 2-methylpropyl 2-acetyloxybenzoate. InChIKey: SJDBWYGIHAKIFU-UHFFFAOYSA-N.
| Molecular formula | C13H16O4 |
|---|---|
| Molecular weight | 236.26 g/mol |
| IUPAC name | 2-methylpropyl 2-acetyloxybenzoate |
| InChIKey | SJDBWYGIHAKIFU-UHFFFAOYSA-N |
| SMILES | CC(C)COC(=O)C1=CC=CC=C1OC(=O)C |
Computed by PubChem (NCBI)