Isoindolin-4-amine dihydrochloride, 97%, 97%
cas: 92259-85-3 — see every product listed under this CAS number, including other names
Isoindolin-4-amine dihydrochloride, 97%, 97% (CAS 92259-85-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IH30-50mg |
| cas | 92259-85-3 |
| size | 50mg |
| availability | 10g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 448.40 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 500mg | 1120.40 Pln | |
| Chemat | 1g | 1648.40 Pln | |
| Chemat | 5g | 6126.80 Pln | |
| Chemat | 10g | 10173.20 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,3-dihydro-1H-isoindol-4-amine;dihydrochloride (CAS 92259-85-3) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 2,3-dihydro-1H-isoindol-4-amine;dihydrochloride. InChIKey: PPLZYBVXLJLUNH-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindol-4-amine;dihydrochloride |
| InChIKey | PPLZYBVXLJLUNH-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)
Synonyms:
isoindolin-4-amine dihydrochloride, Isoindolin-4-amine 2HCl, 4-aminoisoindoline HCl, isoindolin-4-amine;dihydrochloride, 2,3-dihydro-1H-isoindol-4-amine;dihydrochloride, 4-aminoisoindoline 2HCl, 4-Aminoisoindoline diHCl, 2,3-Dihydro-1H-isoindol-4-ylamine dihydrochloride, 2,3-Dihydro-1H-isoindol-4-amine--hydrogen chloride (1/2)