CAS 114538-05-5 appears in our catalog under these names: 3-(Chloromethyl)-4,5,6,7-tetrahydro-1h-indazole hydrochloride, 95%, 3-(Chloromethyl)-4,5,6,7-tetrahydro-1H-indazole hydrochloride, 98%, 3-(chloromethyl)-4,5,6,7-tetrahydro-2h-indazole hydrochloride, 3-(Chloromethyl)-4,5,6,7-tetrahydro-1H-indazole Hydrochloride, ≥97%, ≥97%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 250mg, 5g, 1g, 0,5g, 50mg.
3-(chloromethyl)-4,5,6,7-tetrahydro-1H-indazole;hydrochloride (CAS 114538-05-5) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 3-(chloromethyl)-4,5,6,7-tetrahydro-1H-indazole;hydrochloride. InChIKey: ROEHQMDMNFLJQZ-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 3-(chloromethyl)-4,5,6,7-tetrahydro-1H-indazole;hydrochloride |
| InChIKey | ROEHQMDMNFLJQZ-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=NN2)CCl.Cl |
Computed by PubChem (NCBI)