CAS 92259-85-3 appears in our catalog under these names: Isoindolin-4-amine dihydrochloride, 95%, Isoindolin-4-amine dihydrochloride, Isoindolin-4-amine dihydrochloride, 97%, 97%, Isoindolin-4-amine dihydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 50mg, 100mg, 500mg, 5g, 10g.
2,3-dihydro-1H-isoindol-4-amine;dihydrochloride (CAS 92259-85-3) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 2,3-dihydro-1H-isoindol-4-amine;dihydrochloride. InChIKey: PPLZYBVXLJLUNH-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindol-4-amine;dihydrochloride |
| InChIKey | PPLZYBVXLJLUNH-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1)C(=CC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)