CAS 1713164-04-5 appears in our catalog under these names: 4-Cyclopropylpyridin-2-amine dihydrochloride, 95%, 4-Cyclopropylpyridin-2-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-cyclopropylpyridin-2-amine;dihydrochloride (CAS 1713164-04-5) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 4-cyclopropylpyridin-2-amine;dihydrochloride. InChIKey: MXIMIQCZZFFZNX-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 4-cyclopropylpyridin-2-amine;dihydrochloride |
| InChIKey | MXIMIQCZZFFZNX-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC(=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)