CAS 1228880-35-0 appears in our catalog under these names: 1-(4-Pyridinyl)-cyclopropanamine dihydrochloride, 97%, 1-(Pyridin-4-yl)cyclopropanamine dihydrochloride, 98%, Cyclopropanamine, 1-(4-pyridinyl)-, hydrochloride (1:2), 1-(Pyridin-4-yl)cyclopropanamine dihydrochloride, 95%, 95%, 1-(4-PYRIDINYL)-CYCLOPROPANAMINE 2HCL, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 0,5g, 50mg, 100mg.
1-pyridin-4-ylcyclopropan-1-amine;dihydrochloride (CAS 1228880-35-0) is a chemical compound with the molecular formula C8H12Cl2N2 and a molecular weight of 207.10 g/mol. IUPAC name: 1-pyridin-4-ylcyclopropan-1-amine;dihydrochloride. InChIKey: NOQNEQQDDJEAPU-UHFFFAOYSA-N.
| Molecular formula | C8H12Cl2N2 |
|---|---|
| Molecular weight | 207.10 g/mol |
| IUPAC name | 1-pyridin-4-ylcyclopropan-1-amine;dihydrochloride |
| InChIKey | NOQNEQQDDJEAPU-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=NC=C2)N.Cl.Cl |
Computed by PubChem (NCBI)