cas: 96016-96-5 — see every product listed under this CAS number, including other names
Isoindoline-1-carboxylic acid hydrochloride 95% (CAS 96016-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A777016-100mg |
| cas | 96016-96-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 481.62 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1065.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A777016 |
2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride (CAS 96016-96-5) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: 2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride. InChIKey: KPMLOVZNYPOQII-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | 2,3-dihydro-1H-isoindole-1-carboxylic acid;hydrochloride |
| InChIKey | KPMLOVZNYPOQII-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2C(N1)C(=O)O.Cl |
Computed by PubChem (NCBI)