CAS 155709-41-4 appears in our catalog under these names: Isomagnolone, Isomagnolone/ 99.97% (existing batch purity), Isomagnolone, 99.97% ,, 99.97% ,, Isomagnolone, 99.67%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1 mg.
1-[4-(2-hydroxy-5-prop-2-enylphenoxy)phenyl]propan-1-one (CAS 155709-41-4) is a chemical compound with the molecular formula C18H18O3 and a molecular weight of 282.3 g/mol. IUPAC name: 1-[4-(2-hydroxy-5-prop-2-enylphenoxy)phenyl]propan-1-one. InChIKey: LVHHYWFCRQIOJG-UHFFFAOYSA-N.
| Molecular formula | C18H18O3 |
|---|---|
| Molecular weight | 282.3 g/mol |
| IUPAC name | 1-[4-(2-hydroxy-5-prop-2-enylphenoxy)phenyl]propan-1-one |
| InChIKey | LVHHYWFCRQIOJG-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)OC2=C(C=CC(=C2)CC=C)O |
Computed by PubChem (NCBI)