cas: 39562-25-9 — see every product listed under this CAS number, including other names
Isopropyl 2-(3-Nitrobenzylidene)acetoacetate 98% (CAS 39562-25-9) is a chemical reagent available from Chemat. Available pack sizes: 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A765759-10g |
| cas | 39562-25-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 893.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A765759 |
Propan-2-yl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate (CAS 39562-25-9) is a chemical compound with the molecular formula C14H15NO5 and a molecular weight of 277.27 g/mol. IUPAC name: propan-2-yl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate. InChIKey: KSZOTXZFYCRWQK-MDWZMJQESA-N.
| Molecular formula | C14H15NO5 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | propan-2-yl (2E)-2-[(3-nitrophenyl)methylidene]-3-oxobutanoate |
| InChIKey | KSZOTXZFYCRWQK-MDWZMJQESA-N |
| SMILES | CC(C)OC(=O)/C(=C/C1=CC(=CC=C1)[N+](=O)[O-])/C(=O)C |
Computed by PubChem (NCBI)