cas: 899548-78-8 — see every product listed under this CAS number, including other names
JMJD6 inhibitor WL12 (CAS 899548-78-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 200mg. Offered by: GLPBio, TargetMol.
| brand | GLPBio |
|---|---|
| catalog number | GB40246-1 |
| cas | 899548-78-8 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 597.04 Pln | |
| GLPBio | 10mg | 1111.89 Pln | |
| GLPBio | 25mg | 1729.72 Pln | |
| GLPBio | 5mg | 877.87 Pln | |
| TargetMol | 1mg | 405.71 Pln | |
| TargetMol | 5mg | 658.38 Pln | |
| TargetMol | 10mg | 944.03 Pln | |
| TargetMol | 25mg | 1454.96 Pln | |
| TargetMol | 50mg | 2079.36 Pln | |
| TargetMol | 100mg | 2816.68 Pln | |
| TargetMol | 200mg | 3912.32 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one (CAS 899548-78-8) is a chemical compound with the molecular formula C16H11N3O2 and a molecular weight of 277.28 g/mol. IUPAC name: 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one. InChIKey: AFTXOIIKGOXDOT-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O2 |
|---|---|
| Molecular weight | 277.28 g/mol |
| IUPAC name | 3-(3H-imidazo[4,5-c]pyridin-2-yl)-6-methylchromen-2-one |
| InChIKey | AFTXOIIKGOXDOT-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)OC(=O)C(=C2)C3=NC4=C(N3)C=NC=C4 |
Computed by PubChem (NCBI)