Products 2230475-63-3
CAS 2230475-63-3 appears in our catalog under these names: KDM4-IN-4/ 99.61% (existing batch purity), KDM4-IN-4. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 5 mg, 1 mg, 10 mg.
(1R,2S,3R,4S)-3-[(dimethylamino)methyl]-1-phenylbicyclo[2.2.1]heptan-2-ol (CAS 2230475-63-3) is a chemical compound with the molecular formula C16H23NO and a molecular weight of 245.36 g/mol. IUPAC name: (1R,2S,3R,4S)-3-[(dimethylamino)methyl]-1-phenylbicyclo[2.2.1]heptan-2-ol. InChIKey: HGNFUCJMHJYHIN-QCEMKRCNSA-N.
| Molecular formula | C16H23NO |
|---|---|
| Molecular weight | 245.36 g/mol |
| IUPAC name | (1R,2S,3R,4S)-3-[(dimethylamino)methyl]-1-phenylbicyclo[2.2.1]heptan-2-ol |
| InChIKey | HGNFUCJMHJYHIN-QCEMKRCNSA-N |
| SMILES | CN(C)C[C@H]1[C@H]2CC[C@](C2)([C@H]1O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)