CAS 1800405-30-4 appears in our catalog under these names: KL1333/ 99.27% (existing batch purity), KL1333, KL1333 98%, KL1333, 98%, 98%, KL1333, 99.94%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM/1mL, 50 mg.
2-propan-2-yl-3H-benzo[e]benzimidazole-4,5-dione (CAS 1800405-30-4) is a chemical compound with the molecular formula C14H12N2O2 and a molecular weight of 240.26 g/mol. IUPAC name: 2-propan-2-yl-3H-benzo[e]benzimidazole-4,5-dione. InChIKey: AJFWITSBVLLDCC-UHFFFAOYSA-N.
| Molecular formula | C14H12N2O2 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 2-propan-2-yl-3H-benzo[e]benzimidazole-4,5-dione |
| InChIKey | AJFWITSBVLLDCC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC2=C(N1)C(=O)C(=O)C3=CC=CC=C32 |
Computed by PubChem (NCBI)