Products 906669-07-6
CAS 906669-07-6 appears in our catalog under these names: KPLH1130/ 98.43% (existing batch purity), KPLH1130, KPLH1130, ≥98%, ≥98%, KPLH1130, 99.86%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10mM/1mL.
3-(2,4-dihydroxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one (CAS 906669-07-6) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 3-(2,4-dihydroxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one. InChIKey: UUTBMTOBGXJTLN-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 3-(2,4-dihydroxyphenyl)-4-(4-methylphenyl)-1H-1,2,4-triazol-5-one |
| InChIKey | UUTBMTOBGXJTLN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)N2C(=NNC2=O)C3=C(C=C(C=C3)O)O |
Computed by PubChem (NCBI)