CAS 20304-70-5 appears in our catalog under these names: Ethacridine Impurity 11, Ethacridine Impurity 3, 2-Ethoxy-7-nitroacridin-4-amine, 97%. Offered by: Chemat Brand, Hubei YoungXin, AmBeed. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g.
2-ethoxy-6-nitroacridin-9-amine (CAS 20304-70-5) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 2-ethoxy-6-nitroacridin-9-amine. InChIKey: NDKYICANXPTKKC-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 2-ethoxy-6-nitroacridin-9-amine |
| InChIKey | NDKYICANXPTKKC-UHFFFAOYSA-N |
| SMILES | CCOC1=CC2=C(C3=C(C=C(C=C3)[N+](=O)[O-])N=C2C=C1)N |
Computed by PubChem (NCBI)