CAS 116628-20-7 appears in our catalog under these names: [2-(2H-1,2,3-Benzotriazol-2-yl)-4-methylphenoxy]acetic acid, 95%, (2-(2H-1,2,3-Benzotriazol-2-yl)-4-methylphenoxy)acetic Acid, 2-(2-(2H-Benzo(d)(1,2,3)triazol-2-yl)-4-methylphenoxy)acetic acid, 95+%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-[2-(benzotriazol-2-yl)-4-methylphenoxy]acetic acid (CAS 116628-20-7) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 2-[2-(benzotriazol-2-yl)-4-methylphenoxy]acetic acid. InChIKey: GXUSNSHJHHHTQR-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 2-[2-(benzotriazol-2-yl)-4-methylphenoxy]acetic acid |
| InChIKey | GXUSNSHJHHHTQR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OCC(=O)O)N2N=C3C=CC=CC3=N2 |
Computed by PubChem (NCBI)