CAS 857495-45-5 is the registry number for 1-Benzyl-4,6-dimethyl-5-nitro-2-oxo-1,2-dihydropyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-benzyl-4,6-dimethyl-5-nitro-2-oxopyridine-3-carbonitrile (CAS 857495-45-5) is a chemical compound with the molecular formula C15H13N3O3 and a molecular weight of 283.28 g/mol. IUPAC name: 1-benzyl-4,6-dimethyl-5-nitro-2-oxopyridine-3-carbonitrile. InChIKey: BELBWKNCFPUZDP-UHFFFAOYSA-N.
| Molecular formula | C15H13N3O3 |
|---|---|
| Molecular weight | 283.28 g/mol |
| IUPAC name | 1-benzyl-4,6-dimethyl-5-nitro-2-oxopyridine-3-carbonitrile |
| InChIKey | BELBWKNCFPUZDP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=C1[N+](=O)[O-])C)CC2=CC=CC=C2)C#N |
Computed by PubChem (NCBI)