cas: 219310-10-8 — see every product listed under this CAS number, including other names
L-Ăź-Homoisoleucine hydrochloride, 98% (CAS 219310-10-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F045393-250MG |
| cas | 219310-10-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 1112.13 Pln | |
| Fluorochem | 5g | 3777.85 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride (CAS 219310-10-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride. InChIKey: RWKVKXFASXUCRV-RIHPBJNCSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride |
| InChIKey | RWKVKXFASXUCRV-RIHPBJNCSA-N |
| SMILES | CC[C@H](C)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)