Products 1423031-52-0

CAS 1423031-52-0 appears in our catalog under these names: 2-[Ethyl(methyl)amino]-2-methylpropanoic acid hydrochloride, 95%, 2-(Ethyl(methyl)amino)-2-methylpropanoic acid hydrochloride, 95%, 2-(Ethyl(methyl)amino)-2-methylpropanoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 1g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[ethyl(methyl)amino]-2-methylpropanoic acid;hydrochloride (CAS 1423031-52-0) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: 2-[ethyl(methyl)amino]-2-methylpropanoic acid;hydrochloride. InChIKey: OUFOQBDBAGHBLK-UHFFFAOYSA-N.

Identity
Molecular formulaC7H16ClNO2
Molecular weight181.66 g/mol
IUPAC name2-[ethyl(methyl)amino]-2-methylpropanoic acid;hydrochloride
InChIKeyOUFOQBDBAGHBLK-UHFFFAOYSA-N
SMILESCCN(C)C(C)(C)C(=O)O.Cl

Computed by PubChem (NCBI)