CAS 219310-10-8 appears in our catalog under these names: L-Beta-homoisoleucine hydrochloride, 95%, H–?–HoIle–OH?HCl, H-L-beta-HIle-OH*HCl, H-β-HoIle-OH.HCl, 98%, 98%, H-β-HoIle-OH (hydrochloride), 98.0%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, MedChemExpress. Available pack sizes: 100mg, 1g, 5g, 10g, 250mg, 100 mg, 250 mg.
(3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride (CAS 219310-10-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride. InChIKey: RWKVKXFASXUCRV-RIHPBJNCSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride |
| InChIKey | RWKVKXFASXUCRV-RIHPBJNCSA-N |
| SMILES | CC[C@H](C)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)