cas: 219310-10-8 — see every product listed under this CAS number, including other names
H-β-HoIle-OH.HCl, 98%, 98% (CAS 219310-10-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BFHE-250mg |
| cas | 219310-10-8 |
| size | 250mg |
| availability | 9.02g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 203.60 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 2459.60 Pln | |
| Chemat | 100mg | 194.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride (CAS 219310-10-8) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride. InChIKey: RWKVKXFASXUCRV-RIHPBJNCSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3R,4S)-3-amino-4-methylhexanoic acid;hydrochloride |
| InChIKey | RWKVKXFASXUCRV-RIHPBJNCSA-N |
| SMILES | CC[C@H](C)[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)