Products 96386-92-4
CAS 96386-92-4 appears in our catalog under these names: L-Beta-homoleucine hydrochloride, 95%, L-β-homoleucine.HCl, 98+%, H–?–HoLeu–OH?HCl, H-L-beta-HLeu-OH*HCl, H-β-HoLeu-OH.HCl, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Iris Biotech, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
(3S)-3-amino-5-methylhexanoic acid;hydrochloride (CAS 96386-92-4) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (3S)-3-amino-5-methylhexanoic acid;hydrochloride. InChIKey: NXVYPYHWONGEFQ-RGMNGODLSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (3S)-3-amino-5-methylhexanoic acid;hydrochloride |
| InChIKey | NXVYPYHWONGEFQ-RGMNGODLSA-N |
| SMILES | CC(C)C[C@@H](CC(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
(3S)-3-amino-5-methylhexanoic acid hydrochloride, L-beta-Homoleucine hydrochloride, (S)-3-Amino-5-methylhexanoic acid hydrochloride, L-beta-homoleucine-HCl, H-beta-HoLeu-OH.HCl, H-|A-HoLeu-OH.HCl, L-|A-homoleucine.HCl, L-beta-Homoleucine HCl, (3S)-3-amino-5-methylhexanoic acid;hydrochloride, (3S)-3-amino-5-methyl-hexanoic acid;hydrochloride