Products 130477-52-0
CAS 130477-52-0 appears in our catalog under these names: L-655708/ 98.41% (existing batch purity), L–655,708, L-655708, L-655708 99%, L-655708, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg, 250mg, 10 mg.
Ethyl (7S)-15-methoxy-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate (CAS 130477-52-0) is a chemical compound with the molecular formula C18H19N3O4 and a molecular weight of 341.4 g/mol. IUPAC name: ethyl (7S)-15-methoxy-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate. InChIKey: YKYOQIXTECBVBB-AWEZNQCLSA-N.
| Molecular formula | C18H19N3O4 |
|---|---|
| Molecular weight | 341.4 g/mol |
| IUPAC name | ethyl (7S)-15-methoxy-12-oxo-2,4,11-triazatetracyclo[11.4.0.02,6.07,11]heptadeca-1(17),3,5,13,15-pentaene-5-carboxylate |
| InChIKey | YKYOQIXTECBVBB-AWEZNQCLSA-N |
| SMILES | CCOC(=O)C1=C2[C@@H]3CCCN3C(=O)C4=C(N2C=N1)C=CC(=C4)OC |
Computed by PubChem (NCBI)