CAS 5794-13-8 appears in our catalog under these names: L-Asparagine Monohydrate, >95% (HPLC), Asparagine Monohydrate (L-Asparagine Monohydrate), L-Asparagine monohydrate/ 98+%, L(+)-Asparagine monohydrate/ 99%, H-L-Asn-OH*H2O. Offered by: TRC, Mikromol, Chemat, TargetMol, Iris Biotech. Available pack sizes: 10g, 1g, 50g, 250mg, 250g, 1kg, 5g, 500mg.
(2S)-2,4-diamino-4-oxobutanoic acid;hydrate (CAS 5794-13-8) is a chemical compound with the molecular formula C4H10N2O4 and a molecular weight of 150.13 g/mol. IUPAC name: (2S)-2,4-diamino-4-oxobutanoic acid;hydrate. InChIKey: RBMGJIZCEWRQES-DKWTVANSSA-N.
| Molecular formula | C4H10N2O4 |
|---|---|
| Molecular weight | 150.13 g/mol |
| IUPAC name | (2S)-2,4-diamino-4-oxobutanoic acid;hydrate |
| InChIKey | RBMGJIZCEWRQES-DKWTVANSSA-N |
| SMILES | C([C@@H](C(=O)O)N)C(=O)N.O |
Computed by PubChem (NCBI)