cas: 55747-84-7 — see every product listed under this CAS number, including other names
L-Aspartic acid, N-[(1,1-dimethylethoxy)carbonyl]-, dimethyl ester, 95%, 95% (CAS 55747-84-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I0XY-100mg |
| cas | 55747-84-7 |
| size | 100mg |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 453.20 Pln | |
| Chemat | 10g | 712.40 Pln | |
| Chemat | 25g | 1365.20 Pln | |
| Chemat | 100g | 3578.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 55747-84-7) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: DFXUYFITVOWQNH-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | DFXUYFITVOWQNH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)