cas: 55747-84-7 — see every product listed under this CAS number, including other names
(S)-DIMETHYL 2-(TERT-BUTOXYCARBONYLAMINO)SUCCINATE, 95% (CAS 55747-84-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F466681-250MG |
| cas | 55747-84-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 341.56 Pln | |
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1690.05 Pln | |
| Fluorochem | 10g | 2778.21 Pln | |
| Fluorochem | 25g | 5501.21 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate (CAS 55747-84-7) is a chemical compound with the molecular formula C11H19NO6 and a molecular weight of 261.27 g/mol. IUPAC name: dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate. InChIKey: DFXUYFITVOWQNH-ZETCQYMHSA-N.
| Molecular formula | C11H19NO6 |
|---|---|
| Molecular weight | 261.27 g/mol |
| IUPAC name | dimethyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanedioate |
| InChIKey | DFXUYFITVOWQNH-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)